Lactitol is a sugar alcohol derived from lactose, commonly used as a low-calorie sweetener in food products. It provides a similar taste and texture to sugar but with fewer calories and a lower glycemic index, making it suitable for diabetic-friendly and reduced-calorie diets. Additionally, lactitol has prebiotic properties, promoting gut health by supporting beneficial bacteria. It is also used as a laxative due to its osmotic effect in the intestines.
| Catalog Number | R044341 |
| CAS Number | 585-86-4 |
| Synonyms | 4-O-β-D-Galactopyranosyl-D-glucitol; D-4-O-β-D-Galactopyranosyl-glucitol; Lactitol; D-Lactitol; Finlac DC; Importal; Lactiobiosit; Lactit; Lactit M; Lactite; Lactitol ACM 50; Lactitol LC 0; Lactosit; Lactositol; Lacty; Lacty (saccharide); Lacty M; |
| Molecular Formula | C12H24O11 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (2S,3R,4R,5R)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,5,6-pentol |
| InChI | InChI=1S/C12H24O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4-21H,1-3H2/t4-,5+,6+,7+,8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | VQHSOMBJVWLPSR-JVCRWLNRSA-N |
| SMILES | C(C1C(C(C(C(O1)OC(C(CO)O)C(C(CO)O)O)O)O)O)O |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Miller, Larry E., Julia Tennilä, and Arthur C. Ouwehand. "Efficacy and tolerance of lactitol supplementation for adult constipation: a systematic review and meta-analysis." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Clinical and Experimental Gastroenterology</i> 7 (2014): 241.<br /> |
