For research use only. Not for therapeutic Use.
WAY-659873(CAT: I040603) is a selective inhibitor of indoleamine 2,3-dioxygenase 2 (IDO2), an immunoregulatory enzyme involved in tryptophan catabolism and immune tolerance. By specifically targeting IDO2, WAY-659873 suppresses kynurenine production and restores T-cell activity, offering a strategic approach for reversing tumor-induced immunosuppression. This compound is ideal for studying the distinct roles of IDO2—separate from IDO1—in cancer immunology, autoimmune regulation, and inflammation. WAY-659873 supports the development of novel immunotherapeutic strategies aimed at enhancing antitumor immunity or modulating pathogenic immune responses.
| CAS Number | 868268-81-9 |
| Synonyms | 5-fluoro-N-(3-morpholin-4-ylsulfonylphenyl)-1-benzothiophene-2-carboxamide |
| Molecular Formula | C19H17FN2O4S2 |
| Purity | ≥95% |
| IUPAC Name | 5-fluoro-N-(3-morpholin-4-ylsulfonylphenyl)-1-benzothiophene-2-carboxamide |
| InChI | InChI=1S/C19H17FN2O4S2/c20-14-4-5-17-13(10-14)11-18(27-17)19(23)21-15-2-1-3-16(12-15)28(24,25)22-6-8-26-9-7-22/h1-5,10-12H,6-9H2,(H,21,23) |
| InChIKey | MPGGDUJXAJIZPW-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=CC(=C2)NC(=O)C3=CC4=C(S3)C=CC(=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
