For research use only. Not for therapeutic Use.
t-Boc-Aminooxy-PEG2-azide（Cat No.:I014706）is a compact bifunctional linker composed of a Boc-protected aminooxy group and an azide group connected through a two-unit PEG spacer. The Boc group provides temporary protection of the aminooxy moiety, allowing controlled deprotection for selective oxime or hydrazone ligation with aldehydes and ketones. The azide group supports efficient bioorthogonal click chemistry reactions, such as CuAAC or SPAAC. The short PEG2 chain improves solubility, flexibility, and reduces steric hindrance. This versatile reagent is widely applied in bioconjugation, peptide chemistry, and drug discovery for multifunctional molecule construction.
| CAS Number | 252378-68-0 |
| Synonyms | tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]carbamate |
| Molecular Formula | C11H22N4O5 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]carbamate |
| InChI | InChI=1S/C11H22N4O5/c1-11(2,3)20-10(16)14-19-9-8-18-7-6-17-5-4-13-15-12/h4-9H2,1-3H3,(H,14,16) |
| InChIKey | LBQVKQFGGWKBAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
