For research use only. Not for therapeutic Use.
Sulfathiazole Sodium(Cat No.:I001726)is a sulfonamide antibiotic effective against a variety of Gram-positive and Gram-negative bacteria. It works by inhibiting folic acid synthesis, an essential process for bacterial growth and replication. This sodium salt form enhances its solubility, allowing for easier administration in both topical and systemic treatments. Sulfathiazole Sodium is commonly used to treat bacterial infections in both human and veterinary medicine, including respiratory, gastrointestinal, and urinary tract infections. Its role in controlling bacterial infections makes it valuable in therapeutic and preventative healthcare applications.
| CAS Number | 144-74-1 |
| Synonyms | sodium;(4-aminophenyl)sulfonyl-(1,3-thiazol-2-yl)azanide |
| Molecular Formula | C9H8N3NaO2S2 |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO 59 mg/ml |
| Storage | Store at -20C |
| IUPAC Name | sodium;(4-aminophenyl)sulfonyl-(1,3-thiazol-2-yl)azanide |
| InChI | InChI=1S/C9H8N3O2S2.Na/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9;/h1-6H,10H2;/q-1;+1 |
| InChIKey | GWIJGCIVKLITQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)[N-]C2=NC=CS2.[Na+] |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |