10074-G5 (CAT: I000047) is a small molecule inhibitor that specifically targets the interaction between the transcription factor c-Myc and its binding partner Max. By disrupting the c-Myc/Max complex, 10074-G5 inhibits the transcriptional activity of c-Myc, which is known to play a crucial role in cell proliferation and survival. This compound has demonstrated anti-tumor effects in various cancer cell lines and preclinical models. 10074-G5 has been studied for its potential therapeutic applications in cancer treatment, particularly in targeting c-Myc-driven malignancies. Its ability to inhibit c-Myc activity makes it a promising candidate for the development of novel anti-cancer therapies.
Catalog Number | I000047 |
CAS Number | 413611-93-5 |
Synonyms | 10074-G5; 10074G5;;Biphenyl-2-yl-(7-nitrobenzo[1,2,5]oxadiazol-4-yl)amine |
Molecular Formula | C18H12N4O3 |
Purity | ≥95% |
Target | c-Myc |
Solubility | Soluble in DMSO |
Storage | 3 years -20C powder |
InChI | InChI=1S/C18H14N4O3/c23-22(24)18-11-10-16(17-12-19-25-21(17)18)20-15-9-5-4-8-14(15)13-6-2-1-3-7-13/h1-12,19-20H |
InChIKey | KMJPYSQOCBYMCF-UHFFFAOYSA-N |
SMILES | O=[N+](C(C1=NON=C12)=CC=C2NC3=CC=CC=C3C4=CC=CC=C4)[O-] |
Reference | 1: Yap JL, Wang H, Hu A, Chauhan J, Jung KY, Gharavi RB, Prochownik EV, Fletcher 2: Wang H, Chauhan J, Hu A, Pendleton K, Yap JL, Sabato PE, Jones JW, Perri M, Yu |