For research use only. Not for therapeutic Use.
SB-429201（Cat No.:I043931）is a selective small molecule inhibitor designed to target the enzyme FGFR1 (Fibroblast Growth Factor Receptor 1), a key player in cell growth, differentiation, and survival. FGFR1 is often overexpressed or mutated in various cancers, contributing to tumor progression and resistance to therapy. By inhibiting FGFR1, SB-429201 disrupts critical signaling pathways involved in cancer cell proliferation and angiogenesis. This compound shows promise as a therapeutic agent in oncology, particularly for cancers that are driven by aberrant FGFR1 signaling, offering a novel approach to targeted cancer treatment.
| CAS Number | 1027971-34-1 |
| Synonyms | N-(4-phenoxyphenyl)-4-(3-phenylpropanoylamino)benzamide |
| Molecular Formula | C28H24N2O3 |
| Purity | ≥95% |
| IUPAC Name | N-(4-phenoxyphenyl)-4-(3-phenylpropanoylamino)benzamide |
| InChI | InChI=1S/C28H24N2O3/c31-27(20-11-21-7-3-1-4-8-21)29-23-14-12-22(13-15-23)28(32)30-24-16-18-26(19-17-24)33-25-9-5-2-6-10-25/h1-10,12-19H,11,20H2,(H,29,31)(H,30,32) |
| InChIKey | YPXLCXVERGDWHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)NC2=CC=C(C=C2)C(=O)NC3=CC=C(C=C3)OC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
