Riboflavin - CAS 83-88-5

Riboflavin (Cat.No:A000857), known as vitamin B2, is a water-soluble vitamin essential for various cellular processes, including energy production and the metabolism of fats, drugs, and steroids. It also plays a crucial role in maintaining healthy skin, eyes, and nerve functions. Found in foods like dairy, meat, and leafy greens, riboflavin is vital for overall health.

Catalog Number: A000857

CAS Number: 83-88-5

PubChem Substance ID:354326319

Molecular Formula: C17H20N4O6

Molecular Weight:376.36

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

SynonymsVitamin B2; Lactoflavin; Riboflavine; Vitamin G; Lactoflavine

Property

Molecular Formula: C17H20N4O6
Molecular Weight376.36
Purity≥95%
Storage-20°C

Computed Descriptor

InChIInChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1
InChIKeyAUNGANRZJHBGPY-SCRDCRAPSA-N
SMILESCC1=CC2=C(C=C1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(CO)O)O)O