For research use only. Not for therapeutic Use.
Pramipexole dihydrochloride monohydrate(CAT: A001063) is a water-soluble salt form of pramipexole, a non-ergot dopamine agonist with high selectivity for D₂ subfamily receptors, particularly D₃. With the molecular formula C₁₀H₁₇N₃S·2HCl·H₂O, it is widely studied for its role in modulating dopaminergic neurotransmission. In research, it is used to investigate treatments for Parkinson’s disease, restless legs syndrome, and other neurological disorders. Its neuroprotective potential and effects on mood regulation have also made it a focus in depression and neurodegeneration studies. The monohydrate form offers improved stability and handling, making it suitable for pharmaceutical formulation research and neuropharmacological experiments.
| CAS Number | 191217-81-9 |
| Synonyms | NA |
| Molecular Formula | C10H21Cl2N3OS |
| Purity | ≥95% |
| Documentation | |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20C powder |
| IUPAC Name | (6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrate;dihydrochloride |
| InChI | InChI=1S/C10H17N3S.2ClH.H2O/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;;;/h7,12H,2-6H2,1H3,(H2,11,13);2*1H;1H2/t7-;;;/m0.../s1 |
| InChIKey | APVQOOKHDZVJEX-QTPLPEIMSA-N |
| SMILES | CCCNC1CCC2=C(C1)SC(=N2)N.O.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
