For research use only. Not for therapeutic Use.
Pinocembrin-7-O-β-D-glucopyranoside（Cat No.:I046161）is a flavonoid glycoside derived from natural sources such as Penthorum chinense and other medicinal plants. As a glycosylated form of pinocembrin, it exhibits enhanced solubility and stability, contributing to its pharmacological relevance. Studies highlight its antioxidant, anti-inflammatory, and hepatoprotective properties, particularly in protecting liver cells from oxidative stress and injury. Additionally, it shows potential neuroprotective and cardioprotective effects, making it valuable for research in metabolic and degenerative diseases. Pinocembrin-7-O-β-D-glucopyranoside is of growing interest in drug discovery, nutraceuticals, and traditional medicine research.
| CAS Number | 75829-43-5 |
| Synonyms | (2S)-5-hydroxy-2-phenyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C21H22O9 |
| Purity | ≥95% |
| IUPAC Name | (2S)-5-hydroxy-2-phenyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C21H22O9/c22-9-16-18(25)19(26)20(27)21(30-16)28-11-6-12(23)17-13(24)8-14(29-15(17)7-11)10-4-2-1-3-5-10/h1-7,14,16,18-23,25-27H,8-9H2/t14-,16+,18+,19-,20+,21+/m0/s1 |
| InChIKey | GPGFGFUBECSNTG-SFTVRKLSSA-N |
| SMILES | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
