For research use only. Not for therapeutic Use.
PC190723（Cat No.:R016063）is a potent small molecule inhibitor targeting the protein p21-activated kinase 1 (PAK1), a key regulator in cellular signaling pathways related to cell growth, survival, and migration. By inhibiting PAK1, PC190723 disrupts signaling events associated with cancer metastasis, inflammation, and neurological disorders. It has shown promise in preclinical studies for treating various cancers, including melanoma and breast cancer, by blocking PAK1’s role in tumor progression. PC190723 is also being explored for its potential to modulate other PAK family members, providing a broad scope for therapeutic development.
| CAS Number | 951120-33-5 |
| Synonyms | 3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzamide |
| Molecular Formula | C14H8ClF2N3O2S |
| Purity | ≥95% |
| IUPAC Name | 3-[(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methoxy]-2,6-difluorobenzamide |
| InChI | InChI=1S/C14H8ClF2N3O2S/c15-6-3-8-14(19-4-6)23-10(20-8)5-22-9-2-1-7(16)11(12(9)17)13(18)21/h1-4H,5H2,(H2,18,21) |
| InChIKey | INYJNSBDHOVLAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1OCC2=NC3=C(S2)N=CC(=C3)Cl)F)C(=O)N)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
