Nickel bis(dimethyldithiocarbamate) (Cat. No: M080021) is the coordination complex between nickel and dimethyldithiocarbamate. It is the prototype for a large number of bis(dialkhyldithiocarbamate)s of nickel(II), which feature diverse organic substituents, all of which have similar structures. It has been marketed as a fungicide and related complexes are used as stabilizers in polymers.
Catalog Number | M080021 |
CAS Number | 15521-65-0 |
Synonyms | Methyl niclate; Nocrac NMC; Sankel |
Molecular Formula | C6H12N2NiS4 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | N,N-dimethylcarbamodithioate;nickel(2+) |
InChI | InChI=1S/2C3H7NS2.Ni/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
InChIKey | BLCKKNLGFULNRC-UHFFFAOYSA-L |
SMILES | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Ni+2] |
Reference | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1. <span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Coucouvanis, Dimitri. "The chemistry of the dithioacid and 1, 1-dithiolate complexes, 1968–1977." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Prog. Inorg. Chem</i><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”> 26 (1979): 301-469.</span></span></span> |