For research use only. Not for therapeutic Use.
Neomangiferin(CAT:R072626) is a xanthone C-glycoside predominantly found in Anemarrhena asphodeloides and other medicinal plants. It has attracted considerable attention for its wide-ranging pharmacological activities, including antioxidant, anti-inflammatory, antidiabetic, and neuroprotective effects. Research shows that Neomangiferin can regulate glucose and lipid metabolism, improve insulin sensitivity, and suppress inflammatory signaling pathways such as NF-κB and MAPKs. It also exhibits protective roles in cardiovascular and neurodegenerative disease models, highlighting its therapeutic potential beyond metabolic disorders. With its stable glycosidic structure and diverse bioactivity, Neomangiferin serves as a valuable natural compound for drug discovery and biomedical research targeting chronic inflammation, diabetes, and age-related diseases.
| CAS Number | 64809-67-2 |
| Synonyms | 1,3,6-trihydroxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| Molecular Formula | C25H28O16 |
| Purity | ≥95% |
| IUPAC Name | 1,3,6-trihydroxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| InChI | InChI=1S/C25H28O16/c26-4-12-17(31)20(34)22(36)24(39-12)14-8(29)3-11-15(19(14)33)16(30)6-1-10(7(28)2-9(6)38-11)40-25-23(37)21(35)18(32)13(5-27)41-25/h1-3,12-13,17-18,20-29,31-37H,4-5H2/t12-,13-,17-,18-,20+,21+,22-,23-,24+,25-/m1/s1 |
| InChIKey | VUWOVGXVRYBSGI-IRXABLMPSA-N |
| SMILES | C1=C2C(=CC(=C1OC3C(C(C(C(O3)CO)O)O)O)O)OC4=C(C2=O)C(=C(C(=C4)O)C5C(C(C(C(O5)CO)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |