Triheptanoin (CAT: I011400) is a synthetic triglyceride compound consisting of three heptanoic acid (C7) molecules esterified to a glycerol backbone. It is a medium-chain triglyceride (MCT) and is metabolized differently than long-chain triglycerides (LCTs). Triheptanoin is primarily used as a therapeutic agent for the management of certain metabolic disorders, including fatty acid oxidation disorders (FAODs) and glucose transporter type 1 deficiency syndrome (GLUT1-DS). Due to its unique metabolism, triheptanoin provides an alternative energy source that can bypass the impaired metabolic pathways in these disorders. It is metabolized to generate ketone bodies, which can serve as an energy source for the brain and other tissues.
Catalog Number | I011400 |
CAS Number | 620-67-7 |
Synonyms | Dermofeel TC 7; Glycerol triheptanoate; Glyceryl triheptanoate; Lanol 37T?Trienanthoin; Triheptanoic glyceride; Triheptanoin; Trioenanthoin |
Molecular Formula | C24H44O6 |
Purity | 95% |
Target | fatty acid metabolic modulator |
Storage | -20°C |
IUPAC Name | 2,3-di(heptanoyloxy)propyl heptanoate |
InChI | InChI=1S/C24H44O6/c1-4-7-10-13-16-22(25)28-19-21(30-24(27)18-15-12-9-6-3)20-29-23(26)17-14-11-8-5-2/h21H,4-20H2,1-3H3 |
InChIKey | PJHKBYALYHRYSK-UHFFFAOYSA-N |
SMILES | CCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CCCCCC |
Reference | 1: Kim TH, Borges K, Petrou S, Reid CA. Triheptanoin reduces seizure 2: Thomas NK, Willis S, Sweetman L, Borges K. Triheptanoin in acute mouse seizure <br> <br> |