For research use only. Not for therapeutic Use.
Naringin Dihydrochalcone(Cat No.:R063807)is a flavonoid-derived sweetener, synthesized from naringin found in grapefruits and other citrus fruits. Known for being up to 1,500 times sweeter than sugar, it provides a calorie-free sweetness and is used in various food and pharmaceutical formulations. Beyond its sweetening properties, Naringin Dihydrochalcone exhibits antioxidant and anti-inflammatory effects, making it valuable in research on metabolic health and immune modulation. Its unique profile as a non-caloric sweetener with potential health benefits positions Naringin Dihydrochalcone as an attractive compound in functional food and nutraceutical development.
| CAS Number | 18916-17-1 |
| Synonyms | β-D-3,5-Dihydroxy-4-(p-hydroxyhydrocinnamoyl)phenyl 2-O-(6-deoxy-α-L-mannopyranosyl)glucopyranoside; Phloretin, 4’-(2-O-α-L-rhamno-β-D-glucopyranoside); Naringin Dihydrochalcone |
| Molecular Formula | C27H34O14 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | 3 years -20C powder |
| IUPAC Name | 1-[4-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one |
| InChI | InChI=1S/C27H34O14/c1-11-20(33)22(35)24(37)26(38-11)41-25-23(36)21(34)18(10-28)40-27(25)39-14-8-16(31)19(17(32)9-14)15(30)7-4-12-2-5-13(29)6-3-12/h2-3,5-6,8-9,11,18,20-29,31-37H,4,7,10H2,1H3/t11-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | CWBZAESOUBENAP-QVNVHUMTSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C(C(=C3)O)C(=O)CCC4=CC=C(C=C4)O)O)CO)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |