N-Hexanoyl-L-homoserine lactone(Cat No.:M140190) is a type of short-chain N-acyl homoserine lactone (AHL). AHLs are crucial signaling molecules in the quorum sensing system of Gram-negative bacteria. They facilitate intercellular communication and information exchange between bacteria, allowing them to coordinate their behavior as a population. Additionally, AHLs also play a role in the communication between eukaryotic plants and prokaryotic bacteria. They act as mediators in the cross-talk between these organisms, influencing various biological processes. N-Hexanoyl-L-homoserine lactone is one of the many AHLs involved in these communication networks.
Catalog Number | M140190 |
CAS Number | 147852-83-3 |
Synonyms | C6-HSL |
Molecular Formula | C10H17NO3 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | N-[(3S)-2-oxooxolan-3-yl]hexanamide |
InChI | InChI=1S/C10H17NO3/c1-2-3-4-5-9(12)11-8-6-7-14-10(8)13/h8H,2-7H2,1H3,(H,11,12)/t8-/m0/s1 |
InChIKey | ZJFKKPDLNLCPNP-QMMMGPOBSA-N |
SMILES | CCCCCC(=O)NC1CCOC1=O |
Reference | Small molecule inhibitors of bacterial quorum sensing and biofilm formation Geske G.D. et al. J. Am. Chem. Soc. 2005, 127, 12762. <br/><br/>Quorum sensing and Chromobacterium violaceum: exploitation of violacein production and inhibition for the detection of N-acylhomoserine lactones. McClean K.H. et al. Microbiology 1997, 143, 3703.</span></p> |