For research use only. Not for therapeutic Use.
MRGPRX4 Modulator-1（Cat No.:I043698）is a small molecule designed to target and modulate the activity of MRGPRX4, a G protein-coupled receptor (GPCR) involved in immune response and sensory signaling. MRGPRX4 is expressed on mast cells and other immune cells, playing a role in allergic reactions and inflammatory processes. By modulating MRGPRX4, this compound may help regulate mast cell activation, potentially offering therapeutic benefits in conditions such as chronic pain, allergic responses, and other inflammatory disorders. MRGPRX4 Modulator-1 is being explored in research for its potential to treat these immune-related conditions.
| CAS Number | 2492596-61-7 |
| Synonyms | 6-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-4-ethylpyridine-2-carboxylic acid |
| Molecular Formula | C16H13ClF3NO3 |
| Purity | ≥95% |
| IUPAC Name | 6-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-4-ethylpyridine-2-carboxylic acid |
| InChI | InChI=1S/C16H13ClF3NO3/c1-2-9-5-11(21-13(6-9)15(22)23)8-24-14-4-3-10(7-12(14)17)16(18,19)20/h3-7H,2,8H2,1H3,(H,22,23) |
| InChIKey | UNHAKUSQBBXQSU-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=NC(=C1)C(=O)O)COC2=C(C=C(C=C2)C(F)(F)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
