KKL-35(Cat No.:I012530), is a chemical compound with importance in the realm of pharmacology and molecular research. It typically serves as an experimental tool in laboratory studies, particularly in the context of vascular biology and angiogenesis research. KKL-35 is known for its potential to inhibit certain cellular signaling pathways, often those associated with oxidative stress and inflammation. Such inhibition can be valuable in unraveling the underlying mechanisms of diseases like atherosclerosis and cancer.
Catalog Number | I012530 |
CAS Number | 865285-29-6 |
Synonyms | 4-Chloro-N-[5-(4-fluoro-phenyl)-[1,3,4]oxadiazol-2-yl]-benzamide |
Molecular Formula | C15H9ClFN3O2 |
Purity | 95% |
Storage | 2-8°C |
IUPAC Name | 4-chloro-N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
InChI | InChI=1S/C15H9ClFN3O2/c16-11-5-1-9(2-6-11)13(21)18-15-20-19-14(22-15)10-3-7-12(17)8-4-10/h1-8H,(H,18,20,21) |
InChIKey | ZIICPNCCHIUJSX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=NN=C(O2)NC(=O)C3=CC=C(C=C3)Cl)F |