Imidazolidinyl urea（Cat No.:I003437） is an antimicrobial preservative commonly utilized in cosmetic products. It functions by releasing formaldehyde, which helps prevent the growth of bacteria and fungi, thus extending the shelf life of the product. As a formaldehyde releaser, imidazolidinyl urea provides broad-spectrum antimicrobial activity. However, it is worth noting that formaldehyde can be a potential allergen and sensitizer for some individuals.
| Catalog Number | I003437 |
| CAS Number | 39236-46-9 |
| Molecular Formula | C11H16N8O8 |
| Purity | 95% |
| Solubility | DMSO: ≥ 4 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 1-[3-(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]-3-[[[3-(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]carbamoylamino]methyl]urea |
| InChI | InChI=1S/C11H16N8O8/c20-2-18-4(6(22)16-10(18)26)14-8(24)12-1-13-9(25)15-5-7(23)17-11(27)19(5)3-21/h4-5,20-21H,1-3H2,(H2,12,14,24)(H2,13,15,25)(H,16,22,26)(H,17,23,27) |
| InChIKey | ZCTXEAQXZGPWFG-UHFFFAOYSA-N |
| SMILES | C(NC(=O)NC1C(=O)NC(=O)N1CO)NC(=O)NC2C(=O)NC(=O)N2CO |
