Harmine Hydrochloride（Cat No.:T000064）, is a chemical compound derived from certain plant species, including Peganum harmala and Banisteriopsis caapi, used traditionally in various cultures for its psychoactive properties. It acts as a reversible inhibitor of monoamine oxidase enzymes (MAO), playing a role in the regulation of neurotransmitters like serotonin and dopamine. In modern medicine, harmine and its derivatives are studied for their potential therapeutic applications in treating conditions like depression and neurodegenerative diseases.
| Catalog Number | T000064 |
| CAS Number | 343-27-1 |
| Synonyms | 7-Methoxy-1-methyl-9h-pyrido[3,4-b]indole hydrochloride |
| Molecular Formula | C13H13ClN2O |
| Purity | ≥95% |
| Solubility | In water (13.66 mg/L at 25 ?°C) |
| Storage | 2-8°C |
| IUPAC Name | 7-methoxy-1-methyl-9H-pyrido[3,4-b]indole;hydrochloride |
| InChI | InChI=1S/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
| InChIKey | VNPLYCKZIUTKJM-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC2=C1NC3=C2C=CC(=C3)OC.Cl |
| Reference | – Liu H, Han D, Liu Y, Hou X, Wu J, Li H, Yang J, Shen C, Yang G, Fu C, Li X, Che H, Ai J, Zhao S. Harmine hydrochloride inhibits Akt phosphorylation and depletes the pool of cancer stem-like cells of glioblastoma. J Neurooncol. 2013 Mar;112(1):39-48<br /> |
