GW-786034 (Pazopanib)(Cat No.:A000546)is a potent, orally active inhibitor of multiple tyrosine kinases, including VEGFR, PDGFR, and c-Kit. It primarily targets the angiogenic pathways, inhibiting vascular endothelial growth factor receptor (VEGFR) signaling, which plays a key role in tumor growth and metastasis by reducing blood vessel formation. GW-786034 has been extensively studied for its anti-cancer properties, especially in renal cell carcinoma and soft tissue sarcomas. Its ability to disrupt tumor vasculature makes it a critical compound in cancer research and targeted therapy development.
Catalog Number | A000546 |
CAS Number | 444731-52-6 |
Synonyms | 444731-52-6; GW786034; UNII-7RN5DR86CK; GW 78603; Pazopanib [INN] |
Molecular Formula | C₂₁H₂₃N₇O₂S |
Purity | ≥95% |
Target | FGFR |
Solubility | >11mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | 5-[[4-[(2,3-dimethylindazol-6-yl)-methylamino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide |
InChI | InChI=1S/C21H23N7O2S/c1-13-5-6-15(11-19(13)31(22,29)30)24-21-23-10-9-20(25-21)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16/h5-12H,1-4H3,(H2,22,29,30)(H,23,24,25) |
InChIKey | CUIHSIWYWATEQL-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N |
Reference | 1: Yoshihiro T, Tsuchihashi K, Nio K, Arita S, Nakano T, Yasumatsu R, Jiroumaru 2: Ellawatty WEA, Masuo Y, Fujita KI, Yamazaki E, Ishida H, Arakawa H, Nakamichi <br> 4: Hioki T, Takama H, Makita S, Chen KR, Watanabe D, Akiyama M. Leg ulcers 5: Vogelzang NJ, Pal SK, Ghate SR, Swallow E, Li N, Peeples M, Zichlin ML, 6: Bukhari N, Winquist E. Secondary polycythemia due to pazopanib in patients <br> 8: Deguchi S, Mitsuya K, Nakasu Y, Hayashi N, Katagiri H, Murata H, Wasa J, 9: Koutsoukos K, Bamias A, Tzannis K, Espinosa Montaño M, Bozionelou V, 10: Chellappan DK, Chellian J, Ng ZY, Sim YJ, Theng CW, Ling J, Wong M, Foo JH, |