For research use only. Not for therapeutic Use.
GQ-16（Cat No.:I011756）is a selective inhibitor of the G-protein coupled receptor (GPCR) Gq signaling pathway, which is involved in various cellular processes such as contraction, secretion, and cell growth. By targeting the Gq pathway, GQ-16 can modulate the activation of downstream effectors like phospholipase Cβ, impacting processes in the heart, vasculature, and other tissues. GQ-16 is primarily used in research to study the physiological and pathological roles of Gq signaling in diseases such as heart failure, cancer, and neurological disorders, providing insight into potential therapeutic interventions.
| CAS Number | 870554-67-9 |
| Synonyms | (5Z)-5-[(5-bromo-2-methoxyphenyl)methylidene]-3-[(4-methylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Molecular Formula | C19H16BrNO3S |
| Purity | ≥95% |
| IUPAC Name | (5Z)-5-[(5-bromo-2-methoxyphenyl)methylidene]-3-[(4-methylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| InChI | InChI=1S/C19H16BrNO3S/c1-12-3-5-13(6-4-12)11-21-18(22)17(25-19(21)23)10-14-9-15(20)7-8-16(14)24-2/h3-10H,11H2,1-2H3/b17-10- |
| InChIKey | AMLZLORVKZAHOH-YVLHZVERSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=O)/C(=C/C3=C(C=CC(=C3)Br)OC)/SC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
