For research use only. Not for therapeutic Use.
GP1a（Cat No.:I010627）, also known as glycoprotein Ia, is a receptor found on the surface of platelets. It is part of the integrin family and plays a crucial role in platelet adhesion and aggregation during the process of blood clotting. GP1a binds to collagen in the blood vessel walls, triggering platelet activation and contributing to the formation of a clot. This receptor is essential for maintaining hemostasis, and its dysfunction can lead to bleeding disorders or excessive clotting. Targeting GP1a has been explored as a potential therapeutic strategy for controlling platelet-related disorders.
| CAS Number | 511532-96-0 |
| Synonyms | 1-(2,4-dichlorophenyl)-6-methyl-N-piperidin-1-yl-4H-indeno[1,2-c]pyrazole-3-carboxamide |
| Molecular Formula | C23H22Cl2N4O |
| Purity | ≥95% |
| IUPAC Name | 1-(2,4-dichlorophenyl)-6-methyl-N-piperidin-1-yl-4H-indeno[1,2-c]pyrazole-3-carboxamide |
| InChI | InChI=1S/C23H22Cl2N4O/c1-14-5-7-17-15(11-14)12-18-21(23(30)27-28-9-3-2-4-10-28)26-29(22(17)18)20-8-6-16(24)13-19(20)25/h5-8,11,13H,2-4,9-10,12H2,1H3,(H,27,30) |
| InChIKey | FNOMTMVRTBHRET-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(C2)C(=NN3C4=C(C=C(C=C4)Cl)Cl)C(=O)NN5CCCCC5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
