For research use only. Not for therapeutic Use.
Erianin (Cat No.:R024508) is a natural compound found in certain species of orchids, such as Dendrobium chrysotoxum. It is classified as a bibenzyl derivative and has been recognized for its various bioactive properties. Erianin has shown potential anti-inflammatory, antioxidant, and anticancer activities in preclinical studies. Its ability to inhibit tumor growth and induce apoptosis (programmed cell death) makes it a subject of interest in cancer research. As a natural product, Erianin has attracted attention for its potential therapeutic applications, though further research is needed to fully explore its medical uses.
| CAS Number | 95041-90-0 |
| Synonyms | 2-Methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol; NSC 613744 |
| Molecular Formula | C18H22O5 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | 2-8°C |
| IUPAC Name | 2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol |
| InChI | InChI=1S/C18H22O5/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3/h7-11,19H,5-6H2,1-4H3 |
| InChIKey | UXDFUVFNIAJEGM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |