Bifendate(CAT: R041557) is a hepatoprotective medication used to protect and support the liver. Its mode of action involves being a synthetic derivative of schisandrin, a natural compound found in certain plants, particularly in the fruit of Schisandra chinensis (also known as Wu Wei Zi). Bifendate has been studied for its potential pharmacological properties, including its antioxidant and anti-inflammatory effects. It is commonly used in traditional Chinese medicine and modern medicine to treat liver diseases, particularly hepatitis and liver injury.
| Catalog Number | R041557 |
| CAS Number | 73536-69-3 |
| Synonyms | 7,7’-Dimethoxy-[4,4’-Bi-1,3-benzodioxole]-5,5’-dicarboxylic Acid 5,5’-Dimethyl Ester; DDB; DDB; Dimethyl 4,4’-Dimethoxy-5,6,5’,6’-di(methylenedioxy)biphenyl-2,2’-dicarboxylate; Dimethyl dicarboxylate Biphenyl; Diphenyl Dimethyl Bicarboxylate; α-DDB |
| Molecular Formula | C20H18O10 |
| Purity | 95% |
| Storage | Store at -20°C |
| IUPAC Name | methyl 7-methoxy-4-(7-methoxy-5-methoxycarbonyl-1,3-benzodioxol-4-yl)-1,3-benzodioxole-5-carboxylate |
| InChI | InChI=1S/C20H18O10/c1-23-11-5-9(19(21)25-3)13(17-15(11)27-7-29-17)14-10(20(22)26-4)6-12(24-2)16-18(14)30-8-28-16/h5-6H,7-8H2,1-4H3 |
| InChIKey | JMZOMFYRADAWOG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C(=C1)C(=O)OC)C3=C4C(=C(C=C3C(=O)OC)OC)OCO4)OCO2 |
