For research use only. Not for therapeutic Use.
Droxidopa is a synthetic amino acid precursor which acts as a prodrug to the neurotransmitters norepinephrine (noradrenaline) and epinephrine (adrenaline) and it is used to increase the concentrations of these neurotransmitters in the body and brain. Unlike norepinephrine and epinephrine themselves, droxidopa is capable of crossing the protective blood–brain barrier (BBB). It is metabolized by aromatic L-amino acid decarboxylase (AAAD), also known as DOPA decarboxylase (DDC). Droxidopa works by increasing the levels of norepinephrine and epinephrine in the peripheral nervous system (PNS), which induces tachycardia or increased heart rate and hypertension or increased blood pressure, thus enabling the body to maintain blood flow upon and while standing. (Source: http://en.wikipedia.org/wiki/Droxidopa).
CAS Number | 23651-95-8 |
Synonyms | 23651-95-8; L-DOPS; Northera; (2S,3R)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid; Threo-Dopaserine |
Molecular Formula | C9H11NO5 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | <label class= |
InChI | 1S/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8+/m0/s1 |
InChIKey | QXWYKJLNLSIPIN-JGVFFNPUSA-N |
SMILES | C1=CC(=C(C=C1C(C(C(=O)O)N)O)O)O |
Reference | 1: White WB, Hewitt LA, Mehdirad AA. Impact of the Norepinephrine Prodrug 2: Patrick K, Martin T. Effectiveness of droxidopa compared to midodrine in 3: Gupta F, Karabin B, Mehdirad A. Erratum to: Titrating droxidopa to maximize 4: Sun G, Zhou Z, Luo Z, Wang H, Chen L, Xu Y, Li S, Jian W, Zeng J, Hu B, Han X, 5: Gupta F, Karabin B, Mehdirad A. Titrating droxidopa to maximize symptomatic <br> 7: Kremens D, Lew M, Claassen D, Goodman BP. Adding droxidopa to fludrocortisone 8: Guan YQ, Gao M, Deng X, Lv H, Zhang X. Rhodium-catalyzed asymmetric 9: Mehdirad A, Karabin B, Gupta F. Managing neurogenic orthostatic hypotension 10: Claassen D, Lew M. Initiating droxidopa for neurogenic orthostatic |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |