Cyclic GMP - CAS 7665-99-8
Cyclic guanosine monophosphate (Cyclic GMP)(CAT: I025374), also known as cyclic GMP or cGMP, is a cyclic nucleotide derived from guanosine triphosphate (GTP). It serves as a critical second messenger molecule in various cellular signaling pathways. Cyclic GMP plays a key role in mediating the effects of extracellular peptide hormones that bind to cell surface receptors, leading to the activation of intracellular protein kinases. Through its interaction with specific protein kinases, cyclic GMP modulates various cellular processes, including ion channel regulation, smooth muscle relaxation, and gene expression.
Catalog Number: I025374
CAS Number: 7665-99-8
Molecular Formula: C10H12N5O7P
Molecular Weight:345.2078
Purity: 98.0%
Appearance:Solid powder
* For research use only. Not for human or veterinary use.
Synonym
| Synonyms | Cyclic GMP; Guanosine cyclic monophosphate; cGMP; |
|---|
Property
| Molecular Formula: | C10H12N5O7P |
|---|---|
| Molecular Weight | 345.2078 |
| Solubility | To be determined |
| Purity | 98.0% |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
Computed Descriptor
| IUPAC Name | 2-amino-9-((4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)-1,9-dihydro-6H-purin-6-one |
|---|---|
| InChI | InChI=1S/C10H12N5O7P/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | ZOOGRGPOEVQQDX-UUOKFMHZSA-N |
| SMILES | NC1=Nc2n([C@@H]3O[C@@H]4COP(O)(O[C@H]4[C@H]3O)=O)cnc2C(N1)=O |