For research use only. Not for therapeutic Use.
Astaxanthin(Cat No.:R007762)is a powerful carotenoid antioxidant found naturally in marine organisms like algae, shrimp, and salmon. Renowned for its vibrant red-orange pigment, astaxanthin is widely studied for its potential health benefits, including reducing oxidative stress, enhancing immune function, and supporting cardiovascular and skin health. Its strong antioxidant properties make it valuable in nutraceuticals and cosmetic formulations. Additionally, astaxanthin is researched for its potential neuroprotective effects and its role in promoting eye health, making it a versatile compound in health-related studies.
| CAS Number | 472-61-7 |
| Synonyms | (3S,3’S)-3,3′-Dihydroxy-β,β-carotene-4,4′-dione; all-trans-Astaxanthin; trans-Astaxanthin; |
| Molecular Formula | C40H52O4 |
| Purity | ≥95% |
| Target | Vitamin D Related/Nuclear Receptor |
| Storage | -20°C |
| IUPAC Name | (6S)-6-hydroxy-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4S)-4-hydroxy-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| InChI | InChI=1S/C40H52O4/c1-27(17-13-19-29(3)21-23-33-31(5)37(43)35(41)25-39(33,7)8)15-11-12-16-28(2)18-14-20-30(4)22-24-34-32(6)38(44)36(42)26-40(34,9)10/h11-24,35-36,41-42H,25-26H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,27-15+,28-16+,29-19+,30-20+/t35-,36-/m0/s1 |
| InChIKey | MQZIGYBFDRPAKN-UWFIBFSHSA-N |
| SMILES | CC1=C(C(CC(C1=O)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(C(=O)C(CC2(C)C)O)C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |