Cat No: | M080021 |
Cas No: | 15521-65-0 |
Product-Name: | Nickel bis(dimethyldithiocarbamate) |
IUPAC Name: | N,N-dimethylcarbamodithioate;nickel(2+) |
InChI: | InChI=1S/2C3H7NS2.Ni/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
InChIKey: | BLCKKNLGFULNRC-UHFFFAOYSA-L |
SMILES: | CN(C)C(=S)[S-].CN(C)C(=S)[S-].[Ni+2] |
Nickel bis(dimethyldithiocarbamate) (CAS 15521-65-0) is the coordination complex on nickel and dimethyldithiocarbamate. It is the prototype for a large number of bis(dialkhyldithiocarbamate)s of nickel(II), which feature diverse organic substituents, all of which have similar structures. It has been marketed as a fungicide and related complexes are used a stabilizers in polymers.
1. Coucouvanis, Dimitri. "The chemistry of the dithioacid and 1, 1-dithiolate complexes, 1968–1977." Prog. Inorg. Chem 26 (1979): 301-469.
Your information is safe with us.