For research use only. Not for therapeutic Use.
3-Cyano-7-ethoxycoumarin(Cat No.:I000627)is a synthetic coumarin derivative widely utilized in biochemical assays, particularly as a fluorogenic substrate for cytochrome P450 enzymes. Upon enzymatic cleavage, it releases a fluorescent signal, making it valuable for studying enzyme activity, drug metabolism, and inhibitor screening in drug discovery. Its high sensitivity and compatibility with fluorescence-based detection methods make it ideal for assessing the activity of specific P450 isoforms in vitro. Due to its robust and consistent fluorescence response, 3-Cyano-7-ethoxycoumarin supports research in pharmacokinetics and toxicology.
| CAS Number | 117620-77-6 |
| Synonyms | 7-ethoxy-2-oxo-2H-chromene-3-carbonitrile |
| Molecular Formula | C12H9NO3 |
| Purity | ≥95% |
| Target | Cytochrome P450 |
| Solubility | DMSO:15mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 7-ethoxy-2-oxochromene-3-carbonitrile |
| InChI | InChI=1S/C12H9NO3/c1-2-15-10-4-3-8-5-9(7-13)12(14)16-11(8)6-10/h3-6H,2H2,1H3 |
| InChIKey | YAFGHMIAFYQSCF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C(=O)O2)C#N |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |