For research use only. Not for therapeutic Use.
2,3,5-Tri-O-benzyl-D-ribonolactone(Cat No.:M014212)is a protected sugar lactone derivative of D-ribose, featuring benzyl groups at the 2-, 3-, and 5-hydroxyl positions. Its molecular formula is C26H26O5. The benzyl protection enhances stability and lipophilicity, making the compound useful in multi-step organic synthesis, particularly in the preparation of nucleoside analogs and carbohydrate-based pharmaceuticals. The lactone ring structure facilitates regioselective and stereoselective modifications. This compound is commonly employed in medicinal chemistry and oligonucleotide synthesis as a key intermediate, allowing precise manipulation of ribose functionality without undesired side reactions during complex synthetic transformations.
CAS Number | 55094-52-5 |
Synonyms | 1-Chloro-3,5-di-(p-chlorobenzoyl)-2-deoxy-D-ribofuranose;2,3,5-Tri-O-benzyl-D-ribono-1,4-lactone;2,3,5-TRI-O-BENZYL-D-RIBONOLACTONE;(3R,4R,5R)-3,4-bis(benzyloxy)-5-(benzyloxyMethyl)-dihydrofuran-2(3H)-one;2,3,5-Tris-O-(phenylmethyl)-D-ribonic acid γ- |
Molecular Formula | C26H26O5 |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | -20°C |
IUPAC Name | (3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-one |
InChI | InChI=1S/C26H26O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-25H,16-19H2/t23-,24-,25-/m1/s1 |
InChIKey | LDHBSABBBAUMCZ-UBFVSLLYSA-N |
SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@H](C(=O)O2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |