For research use only. Not for therapeutic Use.
YM-58790 (Cat No.: I013593) is a selective and potent leukotriene D4 (LTD4) receptor antagonist, inhibiting the cysteinyl leukotriene pathway involved in inflammation and bronchoconstriction. It has been studied for its potential therapeutic applications in asthma, allergic rhinitis, and other inflammatory respiratory diseases. By blocking LTD4 receptors, YM-58790 reduces airway hyperresponsiveness and mucus production, making it a valuable tool in respiratory and immunology research. Its role in leukotriene signaling suggests potential for drug development targeting allergic and inflammatory conditions.
| CAS Number | 214558-72-2 |
| Molecular Formula | C₂₇H₃₂ClN₃O₂ |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO |
| IUPAC Name | [1-[[4-(methylamino)phenyl]methyl]piperidin-4-yl] N-benzhydrylcarbamate;hydrochloride |
| InChI | InChI=1S/C27H31N3O2.ClH/c1-28-24-14-12-21(13-15-24)20-30-18-16-25(17-19-30)32-27(31)29-26(22-8-4-2-5-9-22)23-10-6-3-7-11-23;/h2-15,25-26,28H,16-20H2,1H3,(H,29,31);1H |
| InChIKey | WKHYQXVQUGLLOZ-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)CN2CCC(CC2)OC(=O)NC(C3=CC=CC=C3)C4=CC=CC=C4.Cl |
| Reference | [1]. Naito R, et al. Selective muscarinic antagonists. I. Synthesis and antimuscarinic properties of 4-piperidyl benzhydrylcarbamate derivatives. Chem Pharm Bull (Tokyo). 1998 Aug;46(8):1274-85. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |