For research use only. Not for therapeutic Use.
YK-3-237（Cat No.:M011459）is a small-molecule modulator known for its selective inhibition of SIRT2 (Sirtuin 2), a NAD⁺-dependent deacetylase implicated in neurodegenerative diseases, cancer, and metabolic disorders. By targeting SIRT2, YK-3-237 promotes acetylation of α-tubulin and other substrates, influencing processes such as cell cycle regulation, oxidative stress response, and neuroinflammation. It has shown promise in preclinical models for restoring cellular homeostasis and reducing neurotoxicity. YK-3-237 is particularly valuable for studying epigenetic regulation, protein acetylation dynamics, and the role of sirtuins in disease.
| CAS Number | 1215281-19-8 |
| Synonyms | [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]boronic acid |
| Molecular Formula | C19H21BO7 |
| Purity | ≥95% |
| IUPAC Name | [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]boronic acid |
| InChI | InChI=1S/C19H21BO7/c1-24-16-8-6-12(9-14(16)20(22)23)5-7-15(21)13-10-17(25-2)19(27-4)18(11-13)26-3/h5-11,22-23H,1-4H3/b7-5+ |
| InChIKey | AKNGHUAJAODDJA-FNORWQNLSA-N |
| SMILES | B(C1=C(C=CC(=C1)/C=C/C(=O)C2=CC(=C(C(=C2)OC)OC)OC)OC)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
