For research use only. Not for therapeutic Use.
yGsy2p-IN-1（Cat No.:I015511）is a selective small-molecule inhibitor of yeast glycogen synthase 2 (Gsy2p), the key enzyme responsible for catalyzing glycogen synthesis in Saccharomyces cerevisiae. By blocking Gsy2p activity, it disrupts glucose storage and alters cellular energy metabolism, making it a valuable probe for studying carbohydrate regulation, glycogen metabolism, and metabolic control mechanisms in eukaryotic cells. yGsy2p-IN-1 is widely used in biochemical and genetic research to explore enzyme kinetics, metabolic pathway interactions, and nutrient sensing, as well as to model human glycogen-related metabolic disorders in simpler systems.
| CAS Number | 2415003-97-1 |
| Synonyms | 4-[4-(4-hydroxyphenyl)-5-(trifluoromethyl)-1H-pyrazol-3-yl]benzene-1,2,3-triol |
| Molecular Formula | C16H11F3N2O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)-5-(trifluoromethyl)-1H-pyrazol-3-yl]benzene-1,2,3-triol |
| InChI | InChI=1S/C16H11F3N2O4/c17-16(18,19)15-11(7-1-3-8(22)4-2-7)12(20-21-15)9-5-6-10(23)14(25)13(9)24/h1-6,22-25H,(H,20,21) |
| InChIKey | ZGYXFHLAPGZNDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(NN=C2C3=C(C(=C(C=C3)O)O)O)C(F)(F)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
