For research use only. Not for therapeutic Use.
Vicine（Cat No.:M071168）is a pyrimidine glycoside naturally found in Vicia faba (fava beans) and related legumes. It consists of a pyrimidine aglycone linked to a glucose molecule. While vicine itself is non-toxic, its hydrolysis product, divicine, can induce oxidative stress in individuals with glucose-6-phosphate dehydrogenase (G6PD) deficiency, leading to favism—an acute hemolytic reaction. Beyond its toxicological relevance, vicine has attracted research interest for its antioxidant and antimicrobial properties. Understanding its metabolism is crucial for improving food safety and nutritional value in legume-based diets.
| CAS Number | 152-93-2 |
| Synonyms | 2,4-diamino-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidin-6-one |
| Molecular Formula | C10H16N4O7 |
| Purity | ≥95% |
| IUPAC Name | 2,4-diamino-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-pyrimidin-6-one |
| InChI | InChI=1S/C10H16N4O7/c11-7-6(8(19)14-10(12)13-7)21-9-5(18)4(17)3(16)2(1-15)20-9/h2-5,9,15-18H,1H2,(H5,11,12,13,14,19)/t2-,3-,4+,5-,9+/m1/s1 |
| InChIKey | KGNGTSCIQCLKEH-SYCVNHKBSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=C(N=C(NC2=O)N)N)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
