For research use only. Not for therapeutic Use.
UZH1b（Cat No.:I044553）is a potent and selective inhibitor of the m6A RNA demethylase ALKBH5, an enzyme involved in the epigenetic regulation of RNA methylation. By targeting ALKBH5, UZH1b modulates N6-methyladenosine (m6A) levels on RNA, affecting processes such as RNA stability, splicing, and translation. It exhibits strong cellular activity and selectivity, making it a valuable chemical probe for studying the biological roles of m6A demethylation. UZH1b holds promise in cancer and stem cell research, where dysregulated RNA methylation contributes to disease development and progression, offering insights into epitranscriptomic therapeutic strategies.
| CAS Number | 2814392-17-9 |
| Synonyms | N-[[(3S)-1-[6-(benzylamino)pyrimidin-4-yl]-3-hydroxypiperidin-3-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]-2-hydroxybenzamide |
| Molecular Formula | C32H42N6O3 |
| Purity | ≥95% |
| IUPAC Name | N-[[(3S)-1-[6-(benzylamino)pyrimidin-4-yl]-3-hydroxypiperidin-3-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]-2-hydroxybenzamide |
| InChI | InChI=1S/C32H42N6O3/c1-31(2)12-15-37(16-13-31)20-25-9-10-26(27(39)17-25)30(40)34-21-32(41)11-6-14-38(22-32)29-18-28(35-23-36-29)33-19-24-7-4-3-5-8-24/h3-5,7-10,17-18,23,39,41H,6,11-16,19-22H2,1-2H3,(H,34,40)(H,33,35,36)/t32-/m0/s1 |
| InChIKey | PWYRDVXYAOGDNK-YTTGMZPUSA-N |
| SMILES | CC1(CCN(CC1)CC2=CC(=C(C=C2)C(=O)NC[C@]3(CCCN(C3)C4=NC=NC(=C4)NCC5=CC=CC=C5)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
