For research use only. Not for therapeutic Use.
USP8-IN-1（Cat No.:I043669）is a small molecule inhibitor that selectively targets the enzyme USP8 (ubiquitin-specific protease 8), a deubiquitinating enzyme involved in regulating protein stability and signaling pathways. USP8 plays a critical role in the regulation of epidermal growth factor receptor (EGFR) signaling and the modulation of various cellular processes, including growth, survival, and response to stress. By inhibiting USP8, USP8-IN-1 has shown promise in preclinical studies as a potential therapeutic agent for treating cancers and other diseases associated with dysregulated protein degradation and signaling pathways.
| CAS Number | 2477650-96-5 |
| Synonyms | 4-(2-amino-4-methoxyphenyl)-N-(4-nitrophenyl)piperazine-1-carbothioamide |
| Molecular Formula | C18H21N5O3S |
| Purity | ≥95% |
| IUPAC Name | 4-(2-amino-4-methoxyphenyl)-N-(4-nitrophenyl)piperazine-1-carbothioamide |
| InChI | InChI=1S/C18H21N5O3S/c1-26-15-6-7-17(16(19)12-15)21-8-10-22(11-9-21)18(27)20-13-2-4-14(5-3-13)23(24)25/h2-7,12H,8-11,19H2,1H3,(H,20,27) |
| InChIKey | LYQOAIJZQPUZEF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2CCN(CC2)C(=S)NC3=CC=C(C=C3)[N+](=O)[O-])N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
