Trans-glutamic acid is an organic compound that occurs naturally in fruits, vegetables, and other plant sources.trans-Glutaconic Acid is used in the synthesis of iso and azokainoids which act as agonists for glutamate receptors.
| Catalog Number | R018319 |
| CAS Number | 628-48-8 |
| Synonyms | (E)-2-Pentenedioic Acid; (E)-Glutaconic Acid; trans-Glutaconic Acid; trans-Glutaconic Acid |
| Molecular Formula | C5H6O4 |
| Purity | 95% |
| Storage | Room temperature |
| IUPAC Name | (E)-pent-2-enedioic acid |
| InChI | InChI=1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1+ |
| InChIKey | XVOUMQNXTGKGMA-OWOJBTEDSA-N |
| SMILES | C(C=CC(=O)O)C(=O)O |
