Tocofersolan（Cat No.:I005386） is a synthetic form of vitamin E that serves as a polyethylene glycol derivative of α-tocopherol. It is commonly used as a vitamin E supplement to treat deficiencies in individuals who have difficulty absorbing fats due to disease. Tocofersolan also finds application in cosmetics and pharmaceuticals as an antioxidant. Its synthetic nature allows for enhanced stability and solubility, making it a versatile option for various formulations requiring the benefits of vitamin E.
| Catalog Number | I005386 |
| CAS Number | 9002-96-4 |
| Molecular Formula | C35H58O6 |
| Purity | 95% |
| Solubility | DMSO: ≥ 5.7 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 1-O-(2-hydroxyethyl) 4-O-[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] butanedioate |
| InChI | InChI=1S/C35H58O6/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-35(8)21-19-30-29(7)33(27(5)28(6)34(30)41-35)40-32(38)18-17-31(37)39-23-22-36/h24-26,36H,9-23H2,1-8H3/t25-,26-,35-/m1/s1 |
| InChIKey | AOBORMOPSGHCAX-AZAGJHQNSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(CC2)(C)CCCC(C)CCCC(C)CCCC(C)C)C)OC(=O)CCC(=O)OCCO)C |
| Reference | <p style=/line-height:25px/> |
