Ticagrelor-d7（Cat No.:R013483） is a deuterated version of Ticagrelor, where seven hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification is crucial for studying the drug’s pharmacokinetics and metabolism, particularly in cardiovascular research where Ticagrelor is used as an antiplatelet agent. The deuterated form provides clearer insights into the absorption, distribution, and elimination of the drug, facilitating the development of improved dosing strategies and therapeutic outcomes. Ticagrelor-d7 is invaluable in clinical research, ensuring precise and reliable analytical results that contribute to the safer and more effective use of antiplatelet therapies.
| Catalog Number | R013483 |
| CAS Number | 1265911-55-4 |
| Synonyms | (1S,2S,3R,5S)-3-[7-[[(1R,2S)-2-(3,4-D1,2-Cyclopentanediolifluorophenyl)cyclopropyl]amino]-5-(propylthio-d7)-3H-1,2,3-triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)-1,2-cyclopentanediol; AR-C 126532XX-d7; AZD 6140-d7; |
| Molecular Formula | C23H21D7F2N6O4S |
| Purity | 95% |
| Storage | -20°C |
| Related CAS | 274693-27-5 (unlabelled) |
| IUPAC Name | (1S,2S,3R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| InChI | InChI=1S/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15+,16+,17-,19-,20+/m0/s1/i1D3,2D2,7D2 |
| InChIKey | OEKWJQXRCDYSHL-MHTCSOGVSA-N |
| SMILES | CCCSC1=NC(=C2C(=N1)N(N=N2)C3CC(C(C3O)O)OCCO)NC4CC4C5=CC(=C(C=C5)F)F |
