For research use only. Not for therapeutic Use.
Thalidomide-O-amido-C6-NH2 hydrochloride（Cat No.:I015417）is a functionalized thalidomide derivative designed for applications in medicinal chemistry and chemical biology. Featuring an amino-alkyl linker attached through an O-amido group, this compound serves as a versatile building block for synthesizing cereblon-binding molecules and targeted protein degraders (PROTACs). The hydrochloride salt enhances solubility and handling in experimental systems. Researchers employ it to investigate protein–ligand interactions, ubiquitin-mediated degradation pathways, and drug design strategies. It is a valuable tool in probing thalidomide analog activity and advancing targeted therapeutic research platforms.
| CAS Number | 2376990-31-5 |
| Synonyms | N-(6-aminohexyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide;hydrochloride |
| Molecular Formula | C21H27ClN4O6 |
| Purity | ≥95% |
| IUPAC Name | N-(6-aminohexyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide;hydrochloride |
| InChI | InChI=1S/C21H26N4O6.ClH/c22-10-3-1-2-4-11-23-17(27)12-31-15-7-5-6-13-18(15)21(30)25(20(13)29)14-8-9-16(26)24-19(14)28;/h5-7,14H,1-4,8-12,22H2,(H,23,27)(H,24,26,28);1H |
| InChIKey | AKGOZIANMTYDFK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCC(=O)NCCCCCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
