For research use only. Not for therapeutic Use.
(tert-Butoxycarbonyl)-D-serine(Cat No.:R043141), commonly abbreviated as Boc-D-serine, is a protected form of the amino acid D-serine. The tert-butoxycarbonyl (Boc) group is used to prevent the amino group from reacting during peptide synthesis, facilitating the selective coupling of the amino acid in complex sequences. Boc-D-serine is primarily utilized in the synthesis of peptides, particularly for research in protein structure, enzymatic activity, and pharmaceutical applications. Upon completion of synthesis, the Boc group can be removed under mildly acidic conditions, revealing the free amino group for further reactions.
| CAS Number | 6368-20-3 |
| Synonyms | (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| Molecular Formula | C8H15NO5 |
| Purity | ≥95% |
| IUPAC Name | (2R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChI | InChI=1S/C8H15NO5/c1-8(2,3)14-7(13)9-5(4-10)6(11)12/h5,10H,4H2,1-3H3,(H,9,13)(H,11,12)/t5-/m1/s1 |
| InChIKey | FHOAKXBXYSJBGX-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |