For research use only. Not for therapeutic Use.
Telomerase-IN-3（Cat No.:I017866）is a small-molecule inhibitor targeting telomerase, the enzyme responsible for elongating telomeres and maintaining chromosomal stability in dividing cells. By suppressing telomerase activity, Telomerase-IN-3 promotes telomere shortening, leading to growth arrest and apoptosis in rapidly proliferating cells such as cancer cells. This compound is a valuable tool for studying telomere biology, cellular aging, and tumorigenesis. It also supports the development of anticancer strategies aimed at targeting telomerase-dependent survival pathways. Telomerase-IN-3 highlights the therapeutic potential of disrupting telomere maintenance in oncology research.
| CAS Number | 150096-77-8 |
| Synonyms | 2-amino-N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]benzamide |
| Molecular Formula | C19H16ClN5O3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]benzamide |
| InChI | InChI=1S/C19H16ClN5O3/c1-11-8-13(6-7-16(11)28-19-22-9-12(20)10-23-19)24-18(27)25-17(26)14-4-2-3-5-15(14)21/h2-10H,21H2,1H3,(H2,24,25,26,27) |
| InChIKey | NLVSCQFSPVSAOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)NC(=O)C2=CC=CC=C2N)OC3=NC=C(C=N3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
