Taurolidine (Cat.No:R045700) is a synthetic derivative of the amino acid taurine. It exhibits antibacterial, antifungal, and antineoplastic properties. Taurolidine’s ability to inhibit biofilm formation and suppress tumor growth has attracted interest in various medical fields, including wound care, catheter-related infections, and potential cancer therapies.
| Catalog Number | R045700 |
| CAS Number | 19388-87-5 |
| Synonyms | 4,4’-Methylenebis[tetrahydro-2H-1,2,4-thiadiazine 1,1,1’,1’-Tetraoxide; ?4,4’-Methylenebis(perhydro-1,2,4-thiadiazin 1,1-dioxide); Taurolin; Tauroline |
| Molecular Formula | C7H16N4O4S2 |
| Purity | 95% |
| Target | Antibiotic |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 4-[(1,1-dioxo-1,2,4-thiadiazinan-4-yl)methyl]-1,2,4-thiadiazinane 1,1-dioxide |
| InChI | InChI=1S/C7H16N4O4S2/c12-16(13)3-1-10(5-8-16)7-11-2-4-17(14,15)9-6-11/h8-9H,1-7H2 |
| InChIKey | AJKIRUJIDFJUKJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)NCN1CN2CCS(=O)(=O)NC2 |
