For research use only. Not for therapeutic Use.
Syringyl alcohol（Cat No.:I018220）is a naturally occurring phenolic compound and one of the primary monolignols involved in lignin biosynthesis. Found in many vascular plants, it contributes to the structural integrity and rigidity of plant cell walls. Its antioxidant and antimicrobial properties make it of interest in pharmacological studies and natural product chemistry. Syringyl alcohol is also significant in biomass research, biofuel production, and the study of lignin degradation pathways. It serves as a valuable biochemical standard for investigating plant metabolism, enzymology, and renewable material applications.
| CAS Number | 530-56-3 |
| Synonyms | 4-(hydroxymethyl)-2,6-dimethoxyphenol |
| Molecular Formula | C9H12O4 |
| Purity | ≥95% |
| IUPAC Name | 4-(hydroxymethyl)-2,6-dimethoxyphenol |
| InChI | InChI=1S/C9H12O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-4,10-11H,5H2,1-2H3 |
| InChIKey | LUOAEJWSKPQLJD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)OC)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
