For research use only. Not for therapeutic Use.
SW155246（Cat No.:R067037）is a potent small molecule inhibitor that targets the STAT3 (Signal Transducer and Activator of Transcription 3) pathway, which plays a critical role in tumorigenesis, immune evasion, and inflammation. By inhibiting STAT3 activation, SW155246 disrupts cancer cell proliferation, survival, and metastasis. It also promotes anti-tumor immune responses by modulating the tumor microenvironment. SW155246 holds significant potential as a therapeutic agent in oncology, particularly for cancers that rely on STAT3 signaling for growth and resistance to conventional therapies, offering a promising strategy for targeted cancer treatment.
| CAS Number | 420092-79-1 |
| Synonyms | 4-chloro-N-(4-hydroxynaphthalen-1-yl)-3-nitrobenzenesulfonamide |
| Molecular Formula | C16H11ClN2O5S |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-N-(4-hydroxynaphthalen-1-yl)-3-nitrobenzenesulfonamide |
| InChI | InChI=1S/C16H11ClN2O5S/c17-13-6-5-10(9-15(13)19(21)22)25(23,24)18-14-7-8-16(20)12-4-2-1-3-11(12)14/h1-9,18,20H |
| InChIKey | JDYDEJYIVZNWQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)NS(=O)(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
