For research use only. Not for therapeutic Use.
SW106065（Cat No.:I044362）is a small-molecule modulator identified for its ability to activate the unfolded protein response (UPR), particularly through the ATF6 (activating transcription factor 6) pathway. By selectively stimulating ATF6 signaling, SW106065 enhances the expression of genes involved in protein folding, quality control, and endoplasmic reticulum (ER) homeostasis. This compound is used in research to explore therapeutic strategies for diseases characterized by ER stress, including neurodegenerative disorders, diabetes, and cancer. Its specificity for ATF6 over other UPR branches makes SW106065 a valuable tool for dissecting ER stress mechanisms and adaptive cellular responses.
| CAS Number | 62289-81-0 |
| Synonyms | N-pyridin-3-ylthiophene-2-carboxamide |
| Molecular Formula | C10H8N2OS |
| Purity | ≥95% |
| IUPAC Name | N-pyridin-3-ylthiophene-2-carboxamide |
| InChI | InChI=1S/C10H8N2OS/c13-10(9-4-2-6-14-9)12-8-3-1-5-11-7-8/h1-7H,(H,12,13) |
| InChIKey | UPLHUDRMLWWFRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NC(=O)C2=CC=CS2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
