For research use only. Not for therapeutic Use.
Sulfadiazine silver salt(Cat No.:R009665) is a combination of sulfadiazine, an antibiotic, and silver, which possesses antimicrobial properties. Its mode of action involves the synergy of both components, making it an effective antimicrobial agent against various bacteria and fungi. Sulfadiazine inhibits the growth of bacteria by interfering with their folic acid synthesis, while silver ions disrupt microbial cell membranes and interfere with their cellular processes. This combination makes sulfadiazine silver salt valuable in the treatment of burns, wounds, and other topical infections. It has been used as a topical antimicrobial agent and in wound dressings to prevent or treat infections and promote wound healing.
| CAS Number | 22199-08-2 |
| Synonyms | [4-Amino-N-(2-pyrimidinyl-kN1)benzenesulfonamidato-kO]silver; 4-Amino-N-2-pyrimidinylbenzenesulfonamide Silver Complex; Dermazin; Flamazine; Flammazine; Silvadene; Silver Sulfadiazine; Sulfadiazine Silver; |
| Molecular Formula | C10H9AgN4O2S |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | silver;(4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide |
| InChI | InChI=1S/C10H9N4O2S.Ag/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10;/h1-7H,11H2;/q-1;+1 |
| InChIKey | UEJSSZHHYBHCEL-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Ag+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |