For research use only. Not for therapeutic Use.
Sulfabenzamide (Cat No.: A000064) is a sulfonamide compound with antimicrobial properties, primarily studied for its potential in treating bacterial infections. It works by inhibiting the synthesis of folic acid in bacteria, a process essential for their growth and survival. This mechanism is shared with other sulfonamide drugs, making it effective against a range of Gram-positive and Gram-negative bacteria. Although not widely used in clinical practice, sulfabenzamide has been explored in research for antibacterial resistance and developing more effective antimicrobial treatments.
| CAS Number | 127-71-9 |
| Synonyms | ultrin, N-Sulfanilylbenzamide |
| Molecular Formula | C13H12N2O3S |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | N-(4-aminophenyl)sulfonylbenzamide |
| InChI | 1S/C13H12N2O3S/c14-11-6-8-12(9-7-11)19(17,18)15-13(16)10-4-2-1-3-5-10/h1-9H,14H2,(H,15,16) |
| InChIKey | PBCZLFBEBARBBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NS(=O)(=O)C2=CC=C(C=C2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |