For research use only. Not for therapeutic Use.
Succinylsulfathiazole(Cat No.:I000591)is a sulfonamide antibiotic that functions by inhibiting the bacteria responsible for folic acid production. By targeting folic acid synthesis, succinylsulfathiazole disrupts the essential metabolic processes of these bacteria, leading to their inhibition or destruction. This antibiotic is commonly used in studies related to folic acid deficiency to prevent the synthesis of folic acid and investigate the impact on cellular functions. Its mechanism of action makes succinylsulfathiazole effective against a range of bacterial infections, making it a valuable therapeutic agent in medical settings.
CAS Number | 116-43-8 |
Molecular Formula | C13H13N3O5S2 |
Purity | ≥95% |
Target | Bacterial |
Solubility | DMSO: ≥ 3.9 mg/mL |
Storage | Store at -20°C |
IUPAC Name | 4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]butanoic acid |
InChI | InChI=1S/C13H13N3O5S2/c17-11(5-6-12(18)19)15-9-1-3-10(4-2-9)23(20,21)16-13-14-7-8-22-13/h1-4,7-8H,5-6H2,(H,14,16)(H,15,17)(H,18,19) |
InChIKey | SKVLYVHULOWXTD-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1NC(=O)CCC(=O)O)S(=O)(=O)NC2=NC=CS2 |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |