For research use only. Not for therapeutic Use.
SPR Inhibitor 3（Cat No.:I017978）is a potent small-molecule inhibitor of sepiapterin reductase (SPR), a key enzyme in the biosynthesis of tetrahydrobiopterin (BH4). By blocking SPR activity, it reduces BH4 levels, impacting nitric oxide synthase and aromatic amino acid hydroxylases, enzymes essential for neurotransmitter synthesis. This compound is widely studied in neurological disease models, including Parkinson’s disease, neuropathic pain, and psychiatric disorders, where BH4 dysregulation plays a role. SPR Inhibitor 3 is valuable for investigating metabolic and neurological pathways and exploring novel therapeutic strategies targeting SPR-related mechanisms.
| CAS Number | 1292285-54-1 |
| Synonyms | N-[2-(5-hydroxy-2-methyl-1H-indol-3-yl)ethyl]-2-methoxyacetamide |
| Molecular Formula | C14H18N2O3 |
| Purity | ≥95% |
| IUPAC Name | N-[2-(5-hydroxy-2-methyl-1H-indol-3-yl)ethyl]-2-methoxyacetamide |
| InChI | InChI=1S/C14H18N2O3/c1-9-11(5-6-15-14(18)8-19-2)12-7-10(17)3-4-13(12)16-9/h3-4,7,16-17H,5-6,8H2,1-2H3,(H,15,18) |
| InChIKey | YBXBWBBVLXZQBJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)O)CCNC(=O)COC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
